| Identification |
| Name: | benzene-1,2,4,5-tetracarboxylic acid, compound with 1-methyl-1H-imidazole (1:4) |
| Synonyms: | 1,2,4,5-Benzenetetracarboxylic acid, compd. with 1-methyl-1H-imidazole (1:4);Pyromellitic acid, tetra-3-methylimidazole salt;Benzene-1,2,4,5-tetracarboxylic acid, compound with 1-methyl-1H-imidazole (1:4);benzene-1,2,4,5-tetracarboxylic acid - 1-methyl-1H-imidazole (1:4) |
| CAS: | 68938-57-8 |
| EINECS: | 273-130-0 |
| Molecular Formula: | C26H30N8O8 |
| Molecular Weight: | 582.5652 |
| InChI: | InChI=1/C10H6O8.4C4H6N2/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16;4*1-6-3-2-5-4-6/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);4*2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 322.1°C |
| Boiling Point: | 585.8°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 322.1°C |
| Safety Data |
| |
 |
