| Identification | |
| Name: | Naphthalene, polymer with chloromethylated biphenyl, sulfonated, sodium salt |
| Synonyms: | Naphthalene, polymer with chloromethylated biphenyl, sulfonated, sodium salt;Naphthalene, polymer with chloromethylated biphenyl, sulfonated, sodium salt Chloromethylbiphenyl, naphthalene polymer, sulfonated, sodium salt;naphthalene, polymer with chloromethylated biphenyl,sulfonated, sodium salt Naphthalene,polymer with chloromethylated biphenyl,sulfonated,sodium salt Chloromethylbiphenyl,naphthalene polymer,sulfonated,sodium salt |
| CAS: | 68951-44-0 |
| Molecular Formula: | C22H18Na+ |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H10.C10H8.Na/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;/h1-10H;1-8H;/q;;+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 105.5°C |
| Boiling Point: | 258°C at 760 mmHg |
| Flash Point: | 105.5°C |
| Safety Data | |
 |
|
