| Identification | |
| Name: | l-Leucine, reaction products with d-glucose and glycerol |
| Synonyms: | L-Leucine, reaction products with D-glucose and glycerol;(2S)-2-amino-4-methyl-pentanoic acid; glycerol; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| CAS: | 68951-61-1 |
| EINECS: | 273-158-3 |
| Molecular Formula: | C15H33NO11 |
| Molecular Weight: | 403.4226 |
| InChI: | InChI=1/C6H13NO2.C6H12O6.C3H8O3/c1-4(2)3-5(7)6(8)9;7-1-3(9)5(11)6(12)4(10)2-8;4-1-3(6)2-5/h4-5H,3,7H2,1-2H3,(H,8,9);1,3-6,8-12H,2H2;3-6H,1-2H2/t5-;3-,4+,5+,6+;/m00./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 286.7°C |
| Boiling Point: | 527.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 286.7°C |
| Safety Data | |
 |
|
