| Identification |
| Name: | C8,(C16-C18)Dialkyl fumarate, vinyl acetate, 2-hydroxyethyl methacrylate polymer |
| Synonyms: | 2-Butenedioic acid (2E)-, di-C8 and C16-18-alkyl esters, polymers with 2-hydroxyethyl methacrylate and vinyl acetate;2-Butenedioic acid (E)-, di-C8 and C16-18-alkyl esters, polymers with 2-hydroxyethyl methacrylate and vinyl acetate |
| CAS: | 68954-16-5 |
| Molecular Formula: | C14H20O9 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C6H10O3.C4H4O4.C4H6O2/c1-5(2)6(8)9-4-3-7;5-3(6)1-2-4(7)8;1-3-6-4(2)5/h7H,1,3-4H2,2H3;1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b;2-1+; |
| Molecular Structure: |
 |
| Properties |
| Safety Data |
| |
 |
