| Identification | |
| Name: | 68441-29-2 |
| Synonyms: | 68441-29-2;AC1L58NY;Ethenylbenzene, diethenylbenzene polymer, chloromethylated, reaction product with dimethylamine;1,3-divinylbenzene; N-methylmethanamine; styrene;1,3-bis(ethenyl)benzene; N-methylmethanamine; styrene;Styrene, divinylbenzene polymer, chloromethylated, reaction product with dimethylamine;68954-52-9;Methanamine, N-methyl-, reaction products with chloromethylated divinylbenzene-styrene polymer |
| CAS: | 68954-52-9 |
| Molecular Formula: | C20H25N |
| Molecular Weight: | 279.4192 |
| InChI: | InChI=1S/C10H10.C8H8.C2H7N/c1-3-9-6-5-7-10(4-2)8-9;1-2-8-6-4-3-5-7-8;1-3-2/h3-8H,1-2H2;2-7H,1H2;3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 74.6°C |
| Boiling Point: | 211.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 74.6°C |
| Safety Data | |
 |
|
