| Identification | |
| Name: | 2(1H)-Pyrimidinone,4-amino-1-b-D-arabinofuranosyl-,hydrochloride (1:1) |
| Synonyms: | 2(1H)-Pyrimidinone,4-amino-1-b-D-arabinofuranosyl-,monohydrochloride (9CI);Cytosine, 1-b-D-arabinofuranosyl-, monohydrochloride (8CI);1-b-D-Arabinofuranosylcytosinehydrochloride;1-b-D-Arabinofuranosylcytosinemonohydrochloride;Arabinofuranosylcytosine hydrochloride;Arabinosylcytosinehydrochloride;Aracytidine hydrochloride;Cytosinearabinoside hydrochloride;Spongocytidine-hydrochloride;U 19920A;Cytarabine HCl; |
| CAS: | 69-74-9 |
| EINECS: | 200-713-9 |
| Molecular Formula: | C9H13N3O5.HCl |
| Molecular Weight: | 243.21662 |
| InChI: | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 283.8°C |
| Boiling Point: | 545.7°C at 760 mmHg |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility: | appreciable |
| Solubility: | appreciable |
| Appearance: | white powder |
| Specification: | Crystalline Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 283.8°C |
| Storage Temperature: | 2-8°C |
| Color: | Prisms from 50% ethanol WHITE TO OFF-WHITE CRYSTALLINE POWDER |
| Usage: | Treatment of leukaemia, especially acute non-lymphoblastic leukaemia. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
