Identification |
Name: | Decanoic acid, ester with triglycerol trioctanoate |
Synonyms: | Decanoic acid, ester with triglycerol trioctanoate;Decansureester mit Triglyceroltrioctanoat |
CAS: | 69070-60-6 |
Molecular Formula: | C13H26O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C13H26O4/c1-2-3-4-5-6-7-8-9-13(16)17-11-12(15)10-14/h12,14-15H,2-11H2,1H3/t12-/m1/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 129.6°C |
Boiling Point: | 369.1°C at 760 mmHg |
Density: | 1.017g/cm3 |
Refractive index: | 1.466 |
Flash Point: | 129.6°C |
Safety Data |
|
 |