| Identification | |
| Name: | Nitrosofluoroethylurea |
| Synonyms: | 2-FLUOROETHYL-NITROSOUREA |
| CAS: | 69112-98-7 |
| Molecular Formula: | C3H6FN3O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C3H6FN3O2/c4-1-2-7(6-9)3(5)8/h1-2H2,(H2,5,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 80.2°C |
| Boiling Point: | 208.9°C at 760 mmHg |
| Density: | 1.49g/cm3 |
| Refractive index: | 1.506 |
| Specification: |
Nitrosofluoroethylurea , its cas register number is 69112-98-7. It also can be called Urea, 1-(2-fluoroethyl)-1-nitroso- ; N-(2-Fluoroethyl)-N-nitrosourea ; and 1-(2-Fluoroethyl)-1-nitroso-urea . |
| Flash Point: | 80.2°C |
| Safety Data | |
 |
|
