| Identification | |
| Name: | Nitrosomethylbis(chloroethyl)urea |
| Synonyms: | BRN 2263769;Nitrosomethylbis(chloroethyl)urea;1,1-Bis-(2-chloroethyl)-3-methyl-3-nitrosourea;1-Nitroso-1-methyl-3,3-bis-(2-chloroethyl)urea;3-Nitroso-1,1-bis-(2-chloroethyl)-3-methylurea;Urea, 1,1-bis(2-chloroethyl)-3-methyl-3-nitroso-;AC1MHJP3;LS-159034;1,1-bis(2-chloroethyl)-3-methyl-3-nitrosourea;69112-99-8 |
| CAS: | 69112-99-8 |
| Molecular Formula: | C6H11Cl2N3O2 |
| Molecular Weight: | 228.0764 |
| InChI: | InChI=1/C6H11Cl2N3O2/c1-10(9-13)6(12)11(4-2-7)5-3-8/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.5°C |
| Boiling Point: | 287.2°C at 760 mmHg |
| Density: | 1.35g/cm3 |
| Refractive index: | 1.53 |
| Specification: |
Nitrosomethylbis(chloroethyl)urea , its cas register number is 69112-99-8. It also can be called Urea, 1,1-bis(2-chloroethyl)-3-methyl-3-nitroso- ; 1-Nitroso-1-methyl-3,3-bis-(2-chloroethyl)urea ; and 1,1-Bis-(2-chloroethyl)-3-methyl-3-nitrosourea . |
| Flash Point: | 127.5°C |
| Safety Data | |
 |
|
