| Identification | |
| Name: | Nitrosochloroethyldiethylurea |
| Synonyms: | Nitrosochloroethyldiethylurea;BRN 2262348;1-(2-chloroethyl)-3,3-diethyl-1-nitrosourea;1-Nitroso-1-(2-chloroethyl)-3,3-diethylurea;Urea, 1-(2-chloroethyl)-3,3-diethyl-1-nitroso-;69113-00-4;AC1L4DSO;LS-159350 |
| CAS: | 69113-00-4 |
| Molecular Formula: | C7H14ClN3O2 |
| Molecular Weight: | 207.658 |
| InChI: | InChI=1/C7H14ClN3O2/c1-3-10(4-2)7(12)11(9-13)6-5-8/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.8°C |
| Boiling Point: | 259.7°C at 760 mmHg |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.507 |
| Specification: |
Nitrosochloroethyldiethylurea , its cas register number is 69113-00-4. It also can be called Urea, 1-(2-chloroethyl)-3,3-diethyl-1-nitroso- ; and 1-Nitroso-1-(2-chloroethyl)-3,3-diethylurea . |
| Flash Point: | 110.8°C |
| Safety Data | |
 |
|
