| Identification | |
| Name: | Amyldichlorarsine |
| Synonyms: | Pentyldichloroarsenic;TL-164 |
| CAS: | 692-95-5 |
| Molecular Formula: | C5H11AsCl2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H11AsCl2/c1-2-3-4-5-6(7)8/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 85.8°C |
| Boiling Point: | 221.3°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Amyldichlorarsine , its cas register number is 692-95-5. It also can be called Dichloropentylarsine ; N-Amyldichlorarsine ; and Arsine, dichloropentyl- . |
| Flash Point: | 85.8°C |
| Safety Data | |
 |
|
