| Identification | |
| Name: | 2-Pyridinamine,6-chloro-3-phenyl- |
| Synonyms: | 2-Amino-6-chloro-3-phenylpyridine;6-Chlor-3-phenylpyridin-2-amin;6-Chloro-3-phenyl-2-pyridinamine;6-Chloro-3-phenylpyridin-2-amine; |
| CAS: | 69214-19-3 |
| Molecular Formula: | C11H9ClN2 |
| Molecular Weight: | 204.66 |
| InChI: | InChI=1/C11H9ClN2/c12-10-7-6-9(11(13)14-10)8-4-2-1-3-5-8/h1-7H,(H2,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.4 ºC |
| Boiling Point: | 354.9 ºC at 760 mmHg |
| Density: | 1.261 g/cm3 |
| Refractive index: | 1.635 |
| Specification: |
It is six-membered heterocyclic compound with alkaline and is raw material for medicine. |
| Flash Point: | 168.4 ºC |
| Safety Data | |
 |
|
