| Identification | |
| Name: | Di-n-octyltin di(1,2-propyleneglycolmaleate) |
| Synonyms: | (5Z,13Z)-9-Methyl-2,2-dioctyl-1,3,8,11-tetraoxa-2-stannacyclopentadeca-5,13-diene-4,7,12,15-tetrone |
| CAS: | 69226-45-5 |
| Molecular Formula: | C27H42O8Sn |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H12O8.2C8H17.Sn/c1-7(19-11(17)5-3-9(14)15)6-18-10(16)4-2-8(12)13;2*1-3-5-7-8-6-4-2;/h2-5,7H,6H2,1H3,(H,12,13)(H,14,15);2*1,3-8H2,2H3;/b4-2+,5-3-;;;/rC16H34Sn.C11H12O8/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;1-7(19-11(17)5-3-9(14)15)6-18-10(16)4-2-8(12)13/h3-16H2,1-2H3;2-5,7H,6H2,1H3,(H,12,13)(H,14,15)/b;4-2+,5-3- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 193.6°C |
| Boiling Point: | 499.9°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Di-n-octyltin di(1,2-propyleneglycolmaleate) , its cas register number is 69226-45-5. It also can be called Stannane, dioctyl(1,2-propylenedioxybis(maleoyldioxy))- ; and Di-n-octyl-zinn-di-(1,2-propylenglykolmaleinat) [German] . |
| Flash Point: | 193.6°C |
| Safety Data | |
 |
|
