Identification |
Name: | 2-piperidin-1-ylethyl 2-(propylsulfanyl)pentanoate hydrochloride |
Synonyms: | 2-Propylthiovaleric acid O-ester with 2-piperidineethanol hydrochloride;Valeric acid, 2-propylthio-, O-ester with 2-piperidineethanol, hydrochloride;AC1MHJWF;LS-161177;2-piperidin-1-ylethyl 2-propylsulfanylpentanoate hydrochloride;69226-68-2 |
CAS: | 69226-68-2 |
Molecular Formula: | C15H30ClNO2S |
Molecular Weight: | 323.9222 |
InChI: | InChI=1/C15H29NO2S.ClH/c1-3-8-14(19-13-4-2)15(17)18-12-11-16-9-6-5-7-10-16;/h14H,3-13H2,1-2H3;1H |
Molecular Structure: |
![(C15H30ClNO2S) 2-Propylthiovaleric acid O-ester with 2-piperidineethanol hydrochloride;Valeric acid, 2-propylthio-,...](https://img.guidechem.com/pic/image/69226-68-2.png) |
Properties |
Flash Point: | 187.1°C |
Boiling Point: | 385.7°C at 760 mmHg |
Flash Point: | 187.1°C |
Safety Data |
|
![](/images/detail_15.png) |