| Identification | |
| Name: | Ethanone,2-bromo-1-cyclopropyl- |
| Synonyms: | (Bromoacetyl)cyclopropane;2-Bromo-1-cyclopropylethanone;Bromomethyl cyclopropyl ketone; |
| CAS: | 69267-75-0 |
| Molecular Formula: | C5H7BrO |
| Molecular Weight: | 163.01 |
| InChI: | InChI=1/C5H7BrO/c6-3-5(7)4-1-2-4/h4H,1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.669g/cm3 |
| Refractive index: | 1.543 |
| Specification: |
2-Bromo-1-cyclopropylethanone with cas registry number of 69267-75-0 is also known as 2-Bromo-1-cyclopropylethanone ; Ethanone, 2-bromo-1-cyclopropyl- ; 2-Bromo-1-Cyclopropyl Ethanone ; 2-Bromo-1-cyclopropyl-ethanone . It is an organic halogen compound with the appearance of slightly yellow liquid . It would emit acrid smoke and irritating fumes when heated to decomposition . It should be stored in a cool, dry place and kept container closed when not in use. |
| Safety Data | |
 |
|
