| Identification | |
| Name: | decanoic acid; 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol; octanoic acid |
| Synonyms: | decanoic acid; 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol; octanoic acid;AC1L3B0P;AC1Q5W5E;AR-1I3560;Decanoic acid, mixed esters with octanoic acid and tetraethylene glycol;Tetraethylene glycol, caprylate caprate diester;Decanoic acid mixed esters with octanoic acid and tetraethylene glycol |
| CAS: | 69278-97-3 |
| Molecular Formula: | C26H54O9 |
| Molecular Weight: | 510.7016 |
| InChI: | InChI=1/C10H20O2.C8H18O5.C8H16O2/c1-2-3-4-5-6-7-8-9-10(11)12;9-1-3-11-5-7-13-8-6-12-4-2-10;1-2-3-4-5-6-7-8(9)10/h2-9H2,1H3,(H,11,12);9-10H,1-8H2;2-7H2,1H3,(H,9,10) |
| Molecular Structure: | ![(C26H54O9) decanoic acid; 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol; octanoic acid;AC1L3B0P;AC1Q5W5E;AR-1I...](https://img.guidechem.com/pic/image/69278-97-3.png) |
| Properties | |
| Flash Point: | 176.7°C |
| Boiling Point: | 328°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 176.7°C |
| Safety Data | |
 |
|
