| Identification |
| Name: | 1-Piperazinamine,4-methyl- |
| Synonyms: | Piperazine,1-amino-4-methyl- (6CI,7CI,8CI);(4-Methylpiperazin-1-yl)amine;1-Methyl-4-aminopiperazine;4-Methyl-1-aminopiperazine;N-Amino-N'-methylpiperazine;N1-Methyl-N4-aminopiperazine;NSC 80649; |
| CAS: | 6928-85-4 |
| EINECS: | 230-053-7 |
| Molecular Formula: | C5H13N3 |
| Molecular Weight: | 115.18 |
| InChI: | InChI=1/C5H13N3/c1-7-2-4-8(6)5-3-7/h2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 180kgs |
| Density: | 0.957 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Air sensitive Light sensitive. |
| Refractive index: | 1.4835-1.4855 |
| Water Solubility: | miscible |
| Solubility: | miscible
|
| Appearance: | clear to light yellow liquid |
| Packinggroup: | III |
| HS Code: | 29335995 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store protected from light. Store under an inert atmosphere. |
| Sensitive: | Air & Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
