| Identification | |
| Name: | N,N'-Diisopropylcarbodiimide |
| Synonyms: | DIC; H-Tyr-Arg-OH; PCI; N,N'-Methanetetraylbis(2-propanamine); DIC; N,N'-Diisopropyl carbodiimide; N,N'-Diisopropylcarbodiimide; N,N'-Methanetetraylbis(1-methylethylamine)N,N'-DIISOPROPYLCARBODIIMIDE; N,N-DIISOPROPYLCARBODIIMIDE; PCI; Carbodiimide, diisopropyl-; diisopropyl-carbodiimid; Diisopropylcarbodiimide; 1,3-Diisopropylcarbodiimide |
| CAS: | 693-13-0 |
| EINECS: | 211-743-7 |
| Molecular Formula: | C7H14N2 |
| Molecular Weight: | 126.2 |
| InChI: | InChI=1/C7H14N2/c1-6(2)8-5-9-7(3)4/h6-7H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2929 6.1/PG 1 |
| Density: | 0.806 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.432-1.435 |
| Solubility: | Insoluble |
| Appearance: | Colorless to pale yellow liquid |
| Specification: |
General Information: As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. Vapors can travel to a source of ignition and flash back. Will burn if involved in a fire. Flammable liquid and vapor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29252000 |
| Sensitive: | Moisture Sensitive |
| Usage: | Used as an antineoplastic. Used in the treatment of malignant melanoma and sarcomas |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
