| Identification | |
| Name: | Spiro[bicyclo[3.1.1]heptane-2,2'-oxirane],6,6-dimethyl- |
| Synonyms: | Pinane,2,10-epoxy- (6CI,7CI,8CI); 2,10-Epoxypinane; b-Pinene epoxide; b-Pinene oxide |
| CAS: | 6931-54-0 |
| EINECS: | 230-055-8 |
| Molecular Formula: | C10H16 O |
| Molecular Weight: | 152.23 |
| InChI: | InChI=1/C10H16O/c1-9(2)7-3-4-10(6-11-10)8(9)5-7/h7-8H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 66 ºC |
| Boiling Point: | 98-100 ºC (27 mmHg) |
| Density: | 0.976 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.476 |
| Alpha: | 6.5 º (NEAT) |
| Appearance: | clear colorless liquid |
| Specification: |
(+)-beta-Pinene oxide , its cas register number is 6931-54-0. It also can be called 2,10-Epoxypinane ; Pinane, 2,10-epoxy- ; beta-Pinene epoxide ; beta-Pinene oxide ; Spiro(bicyclo(3.1.1)heptane-2,2'-oxirane), 6,6-dimethyl- .It is a clear colorless liquid. |
| Flash Point: | 66 ºC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
