| Identification | |
| Name: | Benzoic acid,4-amino-2-methyl-, methyl ester |
| Synonyms: | o-Toluicacid, 4-amino-, methyl ester (6CI,7CI,8CI);4-Amino-2-methylbenzoic acid methylester;Methyl 4-amino-2-methylbenzoate; |
| CAS: | 6933-47-7 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H11NO2/c1-6-5-7(10)3-4-8(6)9(11)12-2/h3-5H,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.132 g/cm3 |
| Refractive index: | 1.559 |
| Specification: |
The 4-Amino-2-methylbenzoic acid methyl ester with the CAS number 6933-47-7 is also called Benzoic acid,4-amino-2-methyl-, methyl ester. The systematic name is methyl 4-amino-2-methylbenzoate. Its molecular formula is C9H11NO2. This chemical belongs to the following product categories: (1)Esters; (2)Phenyls & Phenyl-Het. The properties of the 4-Amino-2-methylbenzoic acid methyl ester are: (1)ACD/LogP: 1.53; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 16; (6)ACD/BCF (pH 7.4): 16; (7)ACD/KOC (pH 5.5): 249; (8)ACD/KOC (pH 7.4): 249; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 52.32Å2; (13)Index of Refraction: 1.559; (14)Molar Refractivity: 47.087 cm3; (15)Molar Volume: 145.882 cm3; (16)Polarizability: 18.667×10-24cm3; (17)Surface Tension: 43.945 dyne/cm; (18)Enthalpy of Vaporization: 54.263 kJ/mol; (19)Vapour Pressure: 0.001 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
