| Identification |
| Name: | 2-Pyridinamine,N-(phenylmethyl)- |
| Synonyms: | Pyridine,2-(benzylamino)- (6CI,7CI,8CI);2-(Benzylamino)pyridine;N-Benzyl-2-aminopyridine;N-Benzyl-2-pyridinamine;N-Benzylpyridine-2-amine;NSC 59833; |
| CAS: | 6935-27-9 |
| EINECS: | 230-060-5 |
| Molecular Formula: | C12H12N2 |
| Molecular Weight: | 184.24 |
| InChI: | InChI=1/C12H12N2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12/h1-9H,10H2,(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.131 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.636 |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white powder |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
