| Identification | |
| Name: | 1,3-Benzenedicarboxylicacid, 4-bromo- |
| Synonyms: | Isophthalicacid, 4-bromo- (8CI); 1,3-Dicarboxy-4-bromobenzene;1-Bromobenzene-2,4-dicarboxylic acid; 4-Bromo-1,3-benzenedicarboxylic acid;4-Bromoisophthalic acid; NSC 38770 |
| CAS: | 6939-93-1 |
| EINECS: | 230-078-3 |
| Molecular Formula: | C8H5 Br O4 |
| Molecular Weight: | 245.03 |
| InChI: | InChI=1/C8H5BrO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 214.2°C |
| Boiling Point: | 430.6°C at 760 mmHg |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | White solid. |
| Specification: |
Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances.Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Minimize dust generation and accumulation. Avoid contact with eyes, skin, and clothing. Keep container tightly closed. Avoid ingestion and inhalation. Use with adequate ventilation. |
| Flash Point: | 214.2°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
