| Identification |
| Name: | Cyclopentanone,2-chloro- |
| CAS: | 694-28-0 |
| EINECS: | 211-769-9 |
| Molecular Formula: | C5H7 Cl O |
| Molecular Weight: | 118.56 |
| InChI: | InChI=1/C5H7ClO/c6-4-2-1-3-5(4)7/h4H,1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 1.185 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.473-1.477 |
| Solubility: | Soluble |
| Appearance: | Clear pink to brown liquid. Aromatic odor. |
| Packinggroup: | I; II; III |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
