| Identification | |
| Name: | 1,2-Cyclohexanediamine |
| Synonyms: | 1,2-Diaminocyclohexane;DHC 99; Dytek DCH 99 |
| CAS: | 694-83-7 |
| EINECS: | 211-776-7 |
| Molecular Formula: | C6H14 N2 |
| Molecular Weight: | 114.22 |
| InChI: | InChI=1S/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Melting Point: | 2-15 ºC |
| Flash Point: | 75 ºC |
| Boiling Point: | 188-192 ºC |
| Density: | 0.931 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.486-1.492 |
| Water Solubility: | MISCIBLE |
| Solubility: | miscible |
| Appearance: | Clear dark yellow liquid. |
| Specification: | clear slightly yellow to yellow liquid usageEng:suzuki reaction Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| HS Code: | 29213099 |
| Flash Point: | 75 ºC |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Usage: | Major uses include synthesis of bicyclic pyrazine derivatives. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
