| Identification | |
| Name: | (2,3,6-trichlorophenyl)acetic acid - N-methylmethanamine (1:1) |
| Synonyms: | Caswell No. 882B;Dimethylamine 2,3,6-trichlorophenylacetate;EPA Pesticide Chemical Code 082605;2,3,6-Trichlorophenylacetic acid, dimethylamine salt;Methanamine, N-methyl-, 2,3,6-trichlorobenzeneacetate;Acetic acid, (2,3,6-trichlorophenyl)-, salt with ME2NH;N-methylmethanamine; 2-(2,3,6-trichlorophenyl)acetic acid;Benzeneacetic acid, 2,3,6-trichloro-, compd. with N-methylmethanamine (1:1);69462-13-1;AC1L1WRK;AG-G-70391;LS-29018;2,3,6-Trichlorophenylacetic acid dimethylamine salt |
| CAS: | 69462-13-1 |
| Molecular Formula: | C10H12Cl3NO2 |
| Molecular Weight: | 284.5668 |
| InChI: | InChI=1/C8H5Cl3O2.C2H7N/c9-5-1-2-6(10)8(11)4(5)3-7(12)13;1-3-2/h1-2H,3H2,(H,12,13);3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 167.6°C |
| Boiling Point: | 353.5°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 167.6°C |
| Safety Data | |
 |
|
