| Identification | |
| Name: | 2,4(1H,3H)-Pyrimidinedione,5-bromo-6-methyl-3-(1-methylpropyl)-, sodium salt (1:1) |
| Synonyms: | 2,4(1H,3H)-Pyrimidinedione,5-bromo-6-methyl-3-(1-methylpropyl)-, sodium salt (9CI); Bromacil-sodium |
| CAS: | 69484-12-4 |
| Molecular Formula: | C9H13 Br N2 O2 . Na |
| Molecular Weight: | 283.0975 |
| InChI: | InChI=1/C9H13BrN2O2.Na/c1-4-5(2)12-8(13)7(10)6(3)11-9(12)14;/h5H,4H2,1-3H3,(H,11,14);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 157.5-160 DEG C |
| Solubility: | SPARINGLY SOL IN HYDROCARBONS Sol in ethanol, acetone, acetonitrile, xylene, and 3% aqueous sodium hydroxide at 134, 167, 71, 32, and 88 g/l, respectively, 25 deg C. In water, 815 mg/l @ 25 deg C |
| Color: | White crystalline solid Colorless crystals |
| Safety Data | |
 |
|
