| Identification | |
| Name: | Arsonous dibromide,As-phenyl- |
| Synonyms: | Arsine,dibromophenyl- (6CI,7CI,8CI); Arsonous dibromide, phenyl- (9CI);Dibromophenylarsine; Phenyldibromoarsine |
| CAS: | 696-24-2 |
| Molecular Formula: | C6H5 As Br2 |
| Molecular Weight: | 311.85 |
| InChI: | InChI=1/C6H5AsBr2/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 112.8°C |
| Boiling Point: | 264.6°C at 760 mmHg |
| Specification: |
Dibromophenylarsine (CAS NO.696-24-2) is also named as 3-16-00-00958 (Beilstein Handbook Reference) ; BRN 2935647 ; Phenylarsonous dibromide ; Phenyldibromoarsine ; Arsine, dibromophenyl- ; Arsonous dibromide, phenyl- (9CI) . |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 112.8°C |
| Safety Data | |
 |
|
