| Identification | |
| Name: | Pyridine,4-(1-methylethyl)- |
| Synonyms: | Pyridine,4-isopropyl- (6CI,7CI,8CI);4-(1-Methylethyl)pyridine;4-Isopropylpyridine; |
| CAS: | 696-30-0 |
| EINECS: | 211-794-5 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-7(2)8-3-5-9-6-4-8/h3-7H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 66°C |
| Boiling Point: | 178 °C |
| Density: | 0,93 g/cm3 |
| Refractive index: | 1.492 |
| Specification: |
4-Isopropylpyridine , its cas register number is 696-30-0. It also can be called 4-(1-Methylethyl)pyridine ; 4-iso-Propylpyridine ; Pyridine, 4-(1-methylethyl)- . 4-Isopropylpyridine (CAS NO.696-30-0) is harmful by inhalation, in contact with skin and if swallowed. And it is irritating to eyes, respiratory system and skin. |
| Flash Point: | 66°C |
| Safety Data | |
 |
|
