| Identification | |
| Name: | 4-Methoxythiophenol |
| Synonyms: | Benzenethiol,p-methoxy- (6CI,7CI,8CI);4-Mercaptoanisole;4-Methoxybenzenethiol;4-Methoxyphenyl mercaptan;4-Methoxyphenylthiol;p-Mercaptoanisole;p-Methoxybenzenethiol;p-Methoxyphenyl mercaptan;p-Methoxyphenylthiol;p-Methoxythiophenol; |
| CAS: | 696-63-9 |
| EINECS: | 211-799-2 |
| Molecular Formula: | C7H8OS |
| Molecular Weight: | 140.2 |
| InChI: | InChI=1/C7H8OS/c1-8-6-2-4-7(9)5-3-6/h2-5,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6 |
| Density: | 1.14 |
| Refractive index: | 1.5821-1.5841 |
| Appearance: | Colorless light yellow liquid |
| Specification: |
4-Methoxythiophenol , with CAS number of 696-63-9, can be called Benzenethiol,p-methoxy- (6CI,7CI,8CI) ; 4-Mercaptoanisole ; 4-Methoxyphenyl mercaptan ; p-Mercaptoanisole ; p-Methoxybenzenethiol ; p-Methoxyphenyl mercaptan ; p-Methoxyphenylthiol ; p-Methoxythiophenol . It is a colorless light yellow liquid. |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
