| Identification | |
| Name: | Mannitol,2,3-O-(hydroxyoxidostibylene)-, monosodium salt (9CI) |
| Synonyms: | Mannitol,2,3-O-(hydroxystibylene)-, Sb-oxide, monosodium salt; Mannitol, cyclic2,3-ester with antimonic acid (H3SbO4), monosodium salt (8CI);1,3,2-Dioxastibolane, mannitol deriv.; NSC 15617 |
| CAS: | 6963-70-8 |
| Molecular Formula: | C6H13 O8 Sb . Na |
| Molecular Weight: | 358.9203 |
| InChI: | InChI=1/C6H14O6.3H2O.Sb/c7-1-3(9)5(11)6(12)4(10)2-8;;;;/h3-12H,1-2H2;3*1H2; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 292.5°C |
| Boiling Point: | 494.9°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Sodium mannitol antimonate (CAS NO.6963-70-8) is also called NSC 15617 . |
| Report: |
Antimony and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 292.5°C |
| Safety Data | |
 |
|
