Identification |
Name: | 2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with diethenylbenzene and methyl 2-methyl-2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with diethenylbenzene and methyl 2-methyl-2-propenoate |
CAS: | 69631-31-8 |
Molecular Formula: | C21H28O5 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C10H10.C6H10O3.C5H8O2/c1-3-9-7-5-6-8-10(9)4-2;1-5(2)6(8)9-4-3-7;1-4(2)5(6)7-3/h3-8H,1-2H2;7H,1,3-4H2,2H3;1H2,2-3H3 |
Molecular Structure: |
![(C21H28O5) 2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with diethenylbenzene and methyl 2-methyl...](https://img1.guidechem.com/chem/e/dict/23/172413.png) |
Properties |
Safety Data |
|
![](/images/detail_15.png) |