| Identification | |
| Name: | Methyl 3-amino-6-bromopyrazine-2-carboxylate |
| Synonyms: | Pyrazinecarboxylicacid, 3-amino-6-bromo-, methyl ester (9CI);3-Amino-6-bromo-2-pyrazinecarboxylic acid methyl ester; |
| CAS: | 6966-01-4 |
| Molecular Formula: | C6H6BrN3O2 |
| Molecular Weight: | 232.03 |
| InChI: | InChI=1/C6H6BrN3O2/c1-12-6(11)4-5(8)9-2-3(7)10-4/h2H,1H3,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 164-166?C |
| Density: | 1.754 g/cm3 |
| Refractive index: | 1.615 |
| Appearance: | Orange solid |
| Specification: |
Methyl 3-amino-6-bromopyrazine-2-carboxylate , with CAS number of 6966-01-4, can be called Pyrazinecarboxylicacid, 3-amino-6-bromo-, methyl ester (9CI) ; 3-Amino-6-bromo-2-pyrazinecarboxylic acid methyl ester ; Methyl3-amino-6-bromopyrazine-2-carboxylate . Methyl 3-amino-6-bromopyrazine-2-carboxylate (CAS NO. 6966-01-4 ) is used as intermediate in organic synthesis . |
| Storage Temperature: | Refrigerator, Under Inert Atmosphere |
| Usage: | Pyrazine derivatives as Axl and C-Met receptor enzyme inhibitors. |
| Safety Data | |
 |
|
