| Identification |
| Name: | 6-aminoindazole |
| Synonyms: | indazol-6-ylamine; Aminoidazole; 98%; 6-Aminoidazole; 6-Aminsindazole |
| CAS: | 6967-12-0 |
| EINECS: | 230-177-1 |
| Molecular Formula: | C7H7N3 |
| Molecular Weight: | 133.15 |
| InChI: | InChI=1/C7H7N3/c8-6-2-1-5-4-9-10-7(5)3-6/h1-4H,8H2,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Density: | 1.367 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.662 |
| Solubility: | Soluble |
| Appearance: | white to yellow powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
