Identification |
Name: | Benzoic acid, 2-bromo-5-methyl- |
Synonyms: | m-Toluicacid, 6-bromo- (6CI,7CI,8CI);NSC 20686; |
CAS: | 6967-82-4 |
Molecular Formula: | C8H7BrO2 |
Molecular Weight: | 215.044 |
InChI: | InChI=1/C8H7BrO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11) |
Molecular Structure: |
 |
Properties |
Density: | 1.599 g/cm3 |
Refractive index: | 1.595 |
Appearance: | white powder |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Storage Temperature: | Room temperature. |
Safety Data |
|
 |