| Identification | |
| Name: | 2,5-Cyclohexadiene-1,4-dione,2,6-dichloro- |
| Synonyms: | Quinone,2,6-dichloro- (3CI); p-Benzoquinone, 2,6-dichloro- (8CI);2,6-Dichloro-1,4-benzoquinone; 2,6-Dichloro-p-benzoquinone;2,6-Dichlorobenzoquinone; 2,6-Dichloroquinone; NSC 6211 |
| CAS: | 697-91-6 |
| EINECS: | 211-810-0 |
| Molecular Formula: | C6H2 Cl2 O2 |
| Molecular Weight: | 176.9843 |
| InChI: | InChI=1S/C6H2Cl2O2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 122-124 °C(lit.) |
| Flash Point: | 98.5°C |
| Boiling Point: | 241.5°C at 760 mmHg |
| Density: | 1.56g/cm3 |
| Refractive index: | 1.568 |
| Specification: | yellow crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 98.5°C |
| Safety Data | |
 |
|
