| Identification |
| Name: | Benzenemethanol,3-methoxy- |
| Synonyms: | 3-methoxy benzylalcohol;Benzylalcohol, m-methoxy- (6CI,7CI,8CI);(3-Methoxyphenyl)methanol;1-(Hydroxymethyl)-3-methoxybenzene;3-Methoxybenzenemethanol;NSC 66559;[3-(Methyloxy)phenyl]methanol;m-Anisalcohol;m-Methoxybenzyl alcohol; |
| CAS: | 6971-51-3 |
| EINECS: | 230-200-5 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-10-8-4-2-3-7(5-8)6-9/h2-5,9H,6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 29 - 30 |
| Flash Point: | 109.9ºC |
| Density: | 1.112 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5425-1.5445 |
| Water Solubility: | immiscible |
| Solubility: | Immiscible with water |
| Appearance: | colorless clear liquid |
| HS Code: | 29094990 |
| Flash Point: | 109.9ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
| |
 |
