| Identification | |
| Name: | 2,4(1H,3H)-Pyrimidinedione,5,6-diamino-1-methyl- |
| Synonyms: | Uracil,5,6-diamino-1-methyl- (6CI);3-Methyl-4,5-diaminouracil;4,5-Diamino-3-methyluracil;5,6-Diamino-1-methyl-2,4(1H,3H)-pyrimidinedione;5,6-Diamino-1-methylpyrimidine-2,4-dione;5,6-Diamino-1-methyluracil;NSC 62597; |
| CAS: | 6972-82-3 |
| Molecular Formula: | C5H8N4O2 |
| Molecular Weight: | 156.14 |
| InChI: | InChI=1/C5H8N4O2/c1-9-3(7)2(6)4(10)8-5(9)11/h6-7H2,1H3,(H,8,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.407 g/cm3 |
| Refractive index: | 1.582 |
| Appearance: | yellow powder |
| Specification: | Safety Statements:26-36/37/39-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 16:Keep away from sources of ignition - No smoking |
| Safety Data | |
 |
|
