| Identification | |
| Name: | 2H-Pyrrol-2-one,1,5-dihydro-4-methoxy- |
| Synonyms: | 3-Pyrrolin-2-one,4-methoxy- (7CI); 4-Methoxy-1,5-dihydropyrrol-2-one; 4-Methoxy-3-pyrrolin-2-one |
| CAS: | 69778-83-2 |
| EINECS: | -0 |
| Molecular Formula: | C5H7 N O2 |
| Molecular Weight: | 113.11 |
| InChI: | InChI=1/C5H7NO2/c1-8-4-2-5(7)6-3-4/h2H,3H2,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.16 g/cm3 |
| Refractive index: | 1.495 |
| Appearance: | white to yellow-beige crystals or crystalline powder |
| Specification: |
4-Methoxy-3-pyrrolin-2-one , its CAS NO. is 69778-83-2, the synonyms are 2H-Pyrrol-2-one, 1,5-dihydro-4-methoxy- ; 1H-2-Pyrrolone, 4-methoxy-2,5-dihydro ; 4-Methoxy-1,5-dihydro-2H-pyrrol-2-one . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
