| Identification | |
| Name: | Nicotinic acid, 3-(2,6-dimethylpiperidino)propyl ester, hydrochloride |
| Synonyms: | NICOTINIC ACID, 3-(2,6-DIMETHYLPIPERIDINO)PROPYL ESTER, HYDROCHLORIDE;3-Pyridinecarboxylic acid, 3-(2,6-dimethylpiperidino)propyl ester, hydrochloride;69782-43-0;AC1L1A0J;LS-96561;2,6-dimethyl-1-{3-[(pyridin-3-ylcarbonyl)oxy]propyl}piperidinium chloride;3-(2,6-dimethylpiperidin-1-ium-1-yl)propyl pyridine-3-carboxylate chloride |
| CAS: | 69782-43-0 |
| Molecular Formula: | C16H24N2O2 . ClH |
| Molecular Weight: | 312.8349 |
| InChI: | InChI=1/C16H24N2O2.ClH/c1-13-6-3-7-14(2)18(13)10-5-11-20-16(19)15-8-4-9-17-12-15;/h4,8-9,12-14H,3,5-7,10-11H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 187.9°C |
| Boiling Point: | 387°C at 760 mmHg |
| Specification: |
Nicotinic acid, 3-(2,6-dimethylpiperidino)propyl ester, hydrochloride , its cas register number is 69782-43-0. It also can be called CID50881 ; and 3-Pyridinecarboxylic acid, 3-(2,6-dimethylpiperidino)propyl ester, hydrochloride . |
| Flash Point: | 187.9°C |
| Safety Data | |
 |
|
