Identification |
Name: | Propanoic acid,2-methyl-, 2-[1,1'-biphenyl]-4-yl-2-oxoethyl ester |
Synonyms: | Isobutyricacid, ester with 2-hydroxy-4'-phenylacetophenone (7CI); Isobutyric acid,p-phenylphenacyl ester (5CI); NSC 115846 |
CAS: | 69787-81-1 |
Molecular Formula: | C18H18 O3 |
Molecular Weight: | 282.3337 |
InChI: | InChI=1/C18H18O3/c1-13(2)18(20)21-12-17(19)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3 |
Molecular Structure: |
![(C18H18O3) Isobutyricacid, ester with 2-hydroxy-4'-phenylacetophenone (7CI); Isobutyric acid,p-phenylphenacyl e...](https://img1.guidechem.com/chem/e/dict/183/69787-81-1.jpg) |
Properties |
Flash Point: | 182.4°C |
Boiling Point: | 415.1°Cat760mmHg |
Density: | 1.102g/cm3 |
Refractive index: | 1.546 |
Flash Point: | 182.4°C |
Safety Data |
|
![](/images/detail_15.png) |