Identification |
Name: | Benzeneethanol, a-methyl- |
CAS: | 698-87-3 |
EINECS: | 211-821-0 |
Molecular Formula: | C9H12 O |
Molecular Weight: | 136.21 |
InChI: | InChI=1/C9H12O/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 85 °C |
Boiling Point: | 213 °C |
Density: | 0.99 |
Refractive index: | n20/D 1.522(lit.) |
Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
Flash Point: | 85 °C |
Safety Data |
|
 |