| Identification | |
| Name: | 1H-Pyrazol-4-amine,1-methyl- |
| Synonyms: | (1-Methyl-1H-pyrazol-4-yl)amine;4-Amino-1-methyl-1H-pyrazole;1-Methyl-1H-pyrazol-4-ylamine; |
| CAS: | 69843-13-6 |
| Molecular Formula: | C4H7N3 |
| Molecular Weight: | 97.12 |
| InChI: | InChI=1/C4H7N3/c1-7-3-4(5)2-6-7/h2-3H,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.6 |
| Specification: |
The 1-Methyl-1H-pyrazol-4-ylamine, with cas registry number 69843-13-6, has the systematic name of 1-methyl-1H-pyrazol-4-amine. And it is also called 1H-Pyrazol-4-amine, 1-methyl-. Physical properties about this chemical are: (1)ACD/LogP: -1.12; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.13; (4)ACD/LogD (pH 7.4): -1.12; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 5.7; (8)ACD/KOC (pH 7.4): 5.89; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 21.06 Å2; (13)Index of Refraction: 1.6; (14)Molar Refractivity: 27.16 cm3; (15)Molar Volume: 79.3 cm3; (16)Polarizability: 10.76×10-24cm3; (17)Surface Tension: 46.8 dyne/cm; (18)Enthalpy of Vaporization: 46.81 kJ/mol; (19)Vapour Pressure: 0.0624 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
