| Identification |
| Name: | phthalic acid, compound with N,N-diethylaniline (1:1) |
| Synonyms: | 1,2-Benzenedicarboxylic acid, compd. with N,N-diethylbenzenamine (1:1);Diethylaniline, phthalic acid salt (1:1);Phthalic acid mono, N,N-diethylalinine salt;Phthalic acid, compound with N,N-diethylaniline (1:1);benzene-1,2-dicarboxylic acid - N,N-diethylaniline (1:1) |
| CAS: | 69847-39-8 |
| EINECS: | 274-151-8 |
| Molecular Formula: | C18H21NO4 |
| Molecular Weight: | 315.3636 |
| InChI: | InChI=1/C10H15N.C8H6O4/c1-3-11(4-2)10-8-6-5-7-9-10;9-7(10)5-3-1-2-4-6(5)8(11)12/h5-9H,3-4H2,1-2H3;1-4H,(H,9,10)(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 196.7°C |
| Boiling Point: | 378.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 196.7°C |
| Safety Data |
| |
 |
