| Identification |
| Name: | Acetaldehyde, (3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)-, reaction products with Me Et ketone |
| Synonyms: | Acetaldehyde, 2-(3,3-dimethylbicyclo(2.2.1)hept-2-ylidene)-, reaction products with Me Et ketone;(3,3-Dimethyl-2-norbornylidene)acetaldehyde, reaction product with methyl ethyl ketone;Acetaldehyde, (3,3-dimethylbicyclo(2.2.1)hept-2-ylidene)-, reaction products with Me Et ketone;(2E)-(3,3-dimethylbicyclo[2.2.1]hept-2-ylidene)ethanal - butan-2-one (1:1) |
| CAS: | 69898-17-5 |
| EINECS: | 274-191-6 |
| Molecular Formula: | C15H24O2 |
| Molecular Weight: | 236.3499 |
| InChI: | InChI=1/C11H16O.C4H8O/c1-11(2)9-4-3-8(7-9)10(11)5-6-12;1-3-4(2)5/h5-6,8-9H,3-4,7H2,1-2H3;3H2,1-2H3/b10-5+; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 114.4°C |
| Boiling Point: | 246°C at 760 mmHg |
| Flash Point: | 114.4°C |
| Safety Data |
| |
 |
