| Identification | |
| Name: | Diethyl sulfoxide |
| Synonyms: | Ethylsulfoxide (6CI,8CI);1,1'-Sulfinylbis(ethane);Diethylsulphoxide;NSC 139125 |
| CAS: | 70-29-1 |
| EINECS: | 200-732-2 |
| Molecular Formula: | C4H10 O S |
| Molecular Weight: | 106.20 |
| InChI: | InChI=1/C4H10OS/c1-3-6(5)4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.02 g/cm3 |
| Refractive index: | 1.477 |
| Specification: |
Diethyl sulfoxide ,its cas register number is 70-29-1. It also can be called Ethyl sulfoxide ; 1,1'-Sulphinylbisethane ; Ethane, 1,1'-sulfinylbis- ; and Ethane, 1,1'-sulfinylbis- . |
| Safety Data | |
 |
|
