| Identification | |
| Name: | Pentamethylbenzene |
| Synonyms: | Pentmethyl Benzene |
| CAS: | 700-12-9 |
| EINECS: | 211-837-8 |
| Molecular Formula: | C11H16 |
| Molecular Weight: | 148.24 |
| InChI: | InChI=1/C11H16/c1-7-6-8(2)10(4)11(5)9(7)3/h6H,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 0.917 |
| Refractive index: | 1.501 |
| Appearance: | white to light yellow crystalline powder |
| Specification: |
Pentamethylbenzene , its cas register number is 700-12-9. It also can be called 1,2,3,4,5-pentamethylbenzene ; and 1,2,3,4,5-Pentamethylbenzene . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
