| Identification | |
| Name: | 5-Methyl-2-nitrophenol |
| Synonyms: | 6-Nitro-m-cresol; 3-Methyl-6-nitrophenol; 3-Hydroxy-4-nitrotoluene |
| CAS: | 700-38-9 |
| EINECS: | 211-843-0 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C7H7NO3/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2446 |
| Density: | 1.32 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Slightly soluble |
| Appearance: | Yellow to green crystals or chunks. |
| Specification: |
Phenol,5-methyl-2-nitro- with cas registry number of 700-38-9 is also called 5-Methyl-2-nitrophenol ; 6-Nitro-m-cresol ; AI3-19031 ; NSC 3142 ; m-Cresol, 6-nitro- . |
| Packinggroup: | III |
| HS Code: | 29089000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
