Identification |
Name: | 2,7-Dichlorofluorene |
Synonyms: | Fluorene,2,7-dichloro- (6CI,7CI,8CI);2,7-Dichloro-9H-fluorene;NSC 73077; |
CAS: | 7012-16-0 |
Molecular Formula: | C13H8Cl2 |
Molecular Weight: | 235.11 |
InChI: | InChI=1/C13H8Cl2/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5H2 |
Molecular Structure: |
 |
Properties |
Melting Point: | 126-128 |
Density: | 1.365 g/cm3 |
Refractive index: | 1.66 |
Appearance: | white crystal |
Specification: |
2,7-Dichlorofluorene , its CAS NO. is 7012-16-0, the synonym is 2,7-Dichloro-9H-fluorene .
|
Storage Temperature: | Refrigerator |
Usage: | Intermediate in the production of Lumefantrine. |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |