| Identification | |
| Name: | 1,1'-Biphenyl,2,4,4'-trichloro- |
| Synonyms: | Biphenyl,2,4,4'-trichloro- (7CI); 2,4,4'-Trichloro-1,1'-biphenyl;2,4,4'-Trichlorobiphenyl; 2',4,4'-Trichlorobiphenyl; 4,2',4'-Trichloro-1,1'-biphenyl;4,2',4'-Trichlorobiphenyl; CB 28; K 28; PCB 28 |
| CAS: | 7012-37-5 |
| EINECS: | 230-293-2 |
| Molecular Formula: | C12H7 Cl3 |
| Molecular Weight: | 257.54 |
| InChI: | InChI=1/C12H7Cl3/c13-9-3-1-8(2-4-9)11-6-5-10(14)7-12(11)15/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2315 |
| Flash Point: | 100 °C |
| Boiling Point: | 330.3°C at 760 mmHg |
| Density: | 1.351g/cm3 |
| Refractive index: | 1.603 |
| Specification: | Safety Statements:35-60-61-62-33-29-16 35:This material and its container must be disposed of in a safe way 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label 33:Take precautionary measures against static discharges 29:Do not empty into drains 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | II |
| Flash Point: | 100 °C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
