| Identification | |
| Name: | Benzeneacetic acid,2-(phenylamino)- |
| Synonyms: | 2-(Phenylamino)benzeneaceticacid; GP 43995 |
| CAS: | 70172-33-7 |
| Molecular Formula: | C14H13 N O2 |
| Molecular Weight: | 227.26 |
| InChI: | InChI=1/C14H13NO2/c16-14(17)10-11-6-4-5-9-13(11)15-12-7-2-1-3-8-12/h1-9,15H,10H2,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.242 g/cm3 |
| Refractive index: | 1.65 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
